CAS 632-50-8
:1,1',1'',1'''-ethane-1,1,2,2-tetrayltetrabenzene
Description:
1,1',1'',1'''-Ethane-1,1,2,2-tetrayltetrabenzene, also known by its CAS number 632-50-8, is a polycyclic aromatic hydrocarbon characterized by its complex structure, which includes multiple benzene rings connected through ethane linkages. This compound exhibits a high degree of symmetry and is typically solid at room temperature. Its molecular structure contributes to its stability and potential applications in materials science, particularly in the development of organic semiconductors and advanced polymers. The presence of multiple aromatic rings imparts significant electronic properties, making it a subject of interest in organic electronics and photonics. Additionally, due to its polycyclic nature, it may exhibit unique optical properties, including fluorescence. However, like many polycyclic aromatic hydrocarbons, it may also raise environmental and health concerns, necessitating careful handling and assessment of its toxicity and environmental impact. Overall, 1,1',1'',1'''-ethane-1,1,2,2-tetrayltetrabenzene represents a fascinating area of study within organic chemistry and materials science.
Formula:C26H22
InChI:InChI=1/C26H22/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22)26(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25-26H
SMILES:c1ccc(cc1)C(c1ccccc1)C(c1ccccc1)c1ccccc1
Synonyms:- .alpha.,.alpha.,.beta.,.beta.-Tetraphenylethane
- Benzene, 1,1',1'',1'''-(1,2-Ethanediylidene)Tetrakis-
- Ethane, 1,1,2,2-tetraphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1,2,2-Tetraphenylethane
CAS:Formula:C26H22Color and Shape:White To Off-White SolidMolecular weight:334.46
