CAS 63200-54-4

2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine

Description:

2,4-Dichloro-5H-pyrrolo[3,2-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. This compound features two chlorine atoms at the 2 and 4 positions of the pyrimidine ring, enhancing its reactivity and potential applications in medicinal chemistry. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of chlorine substituents can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, compounds of this class are often investigated for their biological activity, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. Safety data indicates that, like many chlorinated compounds, it should be handled with care, as it may pose environmental and health risks. Overall, 2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine is of interest in both synthetic and medicinal chemistry contexts.

Formula: C₆H₃Cl₂N₃

InChI: InChI=1/C6H3Cl2N3/c7-5-4-3(1-2-9-4)10-6(8)11-5/h1-2,9H

Synonyms:

• 5H-Pyrrolo[3,2-d]pyrimidine, 2,4-dichloro-
• 7H-Pyrrolo[2,3-d]pyrimidine, 2,4-dichloro-

2,4-Dichloro-5H-pyrrolo[3,2-d]pyrimidine

CAS: 63200-54-4

Formula: C₆H₃Cl₂N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.0141

Ref: IN-DA003FRQ

2,4-Dichloro-5H-pyrrolo[3,2-d]pyrimidine

CAS: 63200-54-4

2,4-Dichloro-5H-pyrrolo[3,2-d]pyrimidine

Purity: 98%

Color and Shape: White Solid

Molecular weight: 188.01g/mol

Ref: 54-OR301065

2,4-Dichloro-5H-pyrrolo[3,2-d]pyrimidine

CAS: 63200-54-4

Formula: C₆H₃Cl₂N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.01

Ref: 10-F076436