CymitQuimica logo

CAS 63201-02-5

:

Cyclopropanecarbonyl chloride, 1-phenyl-

Description:
Cyclopropanecarbonyl chloride, 1-phenyl- is an organic compound characterized by its cyclopropane ring structure attached to a carbonyl chloride functional group and a phenyl group. This compound typically exhibits a molecular structure that includes a three-membered cyclopropane ring, which contributes to its unique reactivity and strain. The presence of the carbonyl chloride functional group indicates that it is a reactive acyl chloride, making it useful in various chemical reactions, particularly in acylation processes. The phenyl group adds aromatic character, influencing the compound's physical and chemical properties, such as solubility and stability. Cyclopropanecarbonyl chloride, 1-phenyl- is generally a colorless to pale yellow liquid, and it may have a pungent odor. It is important to handle this compound with care due to its reactivity and potential hazards associated with acyl chlorides, including corrosiveness and toxicity. As with many organic compounds, it is essential to consider safety protocols when working with this substance in a laboratory setting.
Formula:C10H9ClO
InChI:InChI=1S/C10H9ClO/c11-9(12)10(6-7-10)8-4-2-1-3-5-8/h1-5H,6-7H2
InChI key:NSSCREWKCZJMTL-UHFFFAOYSA-N
SMILES:C1CC1(C2=CC=CC=C2)C(=O)Cl
Found 4 products.