CAS 63206-77-9

[1,2,4]triazolo[4,3-a]pyrimidin-3(2H)-one

Description:

[1,2,4]triazolo[4,3-a]pyrimidin-3(2H)-one is a heterocyclic compound characterized by its fused triazole and pyrimidine rings. This compound features a triazole ring, which consists of three nitrogen atoms and two carbon atoms, fused to a pyrimidine ring that contains two nitrogen atoms and four carbon atoms. The presence of the carbonyl group (C=O) at the 3-position of the pyrimidine contributes to its reactivity and potential biological activity. This compound is often studied for its pharmacological properties, including potential applications in medicinal chemistry as an antitumor or antimicrobial agent. Its structural features allow for various interactions with biological targets, making it a subject of interest in drug development. Additionally, [1,2,4]triazolo[4,3-a]pyrimidin-3(2H)-one may exhibit solubility in polar solvents, which can influence its bioavailability and efficacy. Overall, this compound represents a significant class of nitrogen-containing heterocycles with diverse applications in chemistry and pharmacology.

Formula: C₅H₄N₄O

InChI: InChI=1/C5H4N4O/c10-5-8-7-4-6-2-1-3-9(4)5/h1-3H,(H,8,10)

SMILES: c1cnc2nnc(n2c1)O

Synonyms:

• 1,2,4-triazolo[4,3-a]pyrimidin-3(2H)-one

[1,2,4]Triazolo[4,3-a]pyrimidin-3(2H)-one

CAS: 63206-77-9

Formula: C₅H₄N₄O

Purity: 98%

Color and Shape: Solid

Molecular weight: 136.1115

Ref: IN-DA00EKUA

[1,2,4]Triazolo[4,3-a]pyrimidin-3(2H)-one

CAS: 63206-77-9

[1,2,4]Triazolo[4,3-a]pyrimidin-3(2H)-one

Purity: 98%

Molecular weight: 136.11g/mol

Ref: 54-OR85787

[1,2,4]Triazolo[4,3-a]pyrimidin-3(2H)-one

CAS: 63206-77-9

Formula: C₅H₄N₄O

Purity: 98%

Color and Shape: Solid

Molecular weight: 136.114

Ref: 10-F430656