CAS 6322-83-4
:(4-benzoylphenoxy)acetic acid
Description:
(4-benzoylphenoxy)acetic acid, with the CAS number 6322-83-4, is an organic compound characterized by its structure, which includes a phenoxy group and a benzoyl moiety attached to an acetic acid backbone. This compound typically appears as a white to off-white solid and is soluble in organic solvents, but its solubility in water is limited due to its hydrophobic characteristics. It exhibits properties that make it useful in various applications, including as an intermediate in organic synthesis and potentially in pharmaceuticals. The presence of the benzoyl group may impart certain reactivity, allowing for further chemical modifications. Additionally, the compound may exhibit biological activity, which can be of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, (4-benzoylphenoxy)acetic acid is a versatile compound with potential applications in both industrial and research settings.
Formula:C15H12O4
InChI:InChI=1/C15H12O4/c16-14(17)10-19-13-8-6-12(7-9-13)15(18)11-4-2-1-3-5-11/h1-9H,10H2,(H,16,17)
SMILES:c1ccc(cc1)C(=O)c1ccc(cc1)OCC(=O)O
Synonyms:- (4-Benzoyl-phenoxy)-acetic acid
- Acetic acid, (4-benzoylphenoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(4-BENZOYL-PHENOXY)-ACETIC ACID
CAS:Formula:C15H12O4Purity:98%Color and Shape:SolidMolecular weight:256.25342-(4-Benzoylphenoxy)acetic acid
CAS:2-(4-Benzoylphenoxy)acetic acidPurity:97%Molecular weight:256.25g/mol2-(4-Benzoylphenoxy)acetic acid
CAS:<p>2-(4-Benzoylphenoxy)acetic acid is a phenoxy compound that can be used as an antinociceptive agent. It has been shown to inhibit the pain response in mice by binding to the peripheral cannabinoid receptor CB2 and blocking intracellular calcium channels, thereby inhibiting the release of pro-inflammatory molecules. 2-(4-Benzoylphenoxy)acetic acid also inhibits the activity of two enzymes involved in carbonic acid production and glucose metabolism, which may provide protection against metabolic disorders. Computational methods have been used to model the molecular structure of 2-(4-benzoylphenoxy)acetic acid, which are then compared with experimental data on hydrogen bonding interactions between dihedral angles and intramolecular hydrogen bonds.</p>Formula:C15H12O4Purity:Min. 95%Molecular weight:256.25 g/mol



