CAS 63223-86-9: Ginsenoside Rh1
Description:Ginsenoside Rh1 is a natural compound classified as a triterpenoid saponin, primarily derived from ginseng, particularly Panax ginseng. It is known for its structural complexity, featuring a dammarane skeleton, which is characteristic of many ginsenosides. Ginsenoside Rh1 exhibits various biological activities, including anti-inflammatory, antioxidant, and neuroprotective effects, making it of interest in pharmacological research. Its mechanism of action often involves modulation of signaling pathways and interaction with cellular receptors. Additionally, Ginsenoside Rh1 has been studied for its potential benefits in enhancing cognitive function and promoting overall health. The compound is typically extracted from ginseng roots and can be analyzed using techniques such as high-performance liquid chromatography (HPLC) for purity and concentration assessment. Due to its bioactive properties, Ginsenoside Rh1 is often explored in the context of traditional medicine and modern therapeutic applications, although further research is needed to fully elucidate its mechanisms and potential health benefits.
Formula:C36H62O9
InChI:InChI=1S/C36H62O9/c1-19(2)10-9-13-36(8,43)20-11-15-34(6)26(20)21(38)16-24-33(5)14-12-25(39)32(3,4)30(33)22(17-35(24,34)7)44-31-29(42)28(41)27(40)23(18-37)45-31/h10,20-31,37-43H,9,11-18H2,1-8H3/t20-,21+,22-,23+,24+,25-,26-,27+,28-,29+,30-,31+,33+,34+,35+,36-/m0/s1
InChI key:InChIKey=RAQNTCRNSXYLAH-RFCGZQMISA-N
SMILES:OCC1OC(OC2CC3(C)C(CC(O)C4C(CCC43C)C(O)(C)CCC=C(C)C)C5(C)CCC(O)C(C)(C)C25)C(O)C(O)C1O
- Synonyms:
- (3beta,6alpha,12beta)-3,12,20-Trihydroxydammar-24-en-6-yl beta-D-glucopyranoside
- (3beta,6alpha,9xi,12beta,13xi)-3,12,20-trihydroxydammar-24-en-6-yl beta-D-glucopyranoside
- (3β,6α,12β)-3,12,20-Trihydroxydammar-24-en-6-yl β-<span class="text-smallcaps">D</span>-glucopyranoside
- 20(S)-Ginsenoside Rh<sub>1</sub>
- Dammarane, β-<span class="text-smallcaps">D</span>-glucopyranoside deriv.
- Ginsenoside Rh<sub>1</sub>
- Prosapogenin A<sub>2</sub>
- Rh1 ginsenoside
- Rh<sub>1</sub> ginsenoside
- S-Ginsenoside Rh<sub>1</sub>
- See more synonyms
- Sanchinoside B<sub>2</sub>
- Sanchinoside Rh1
- Sanchinoside Rh<sub>1</sub>
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, (3β,6α,12β)-3,12,20-trihydroxydammar-24-en-6-yl
- (3β,6α,12β)-3,12,20-Trihydroxydammar-24-en-6-yl β-D-glucopyranoside
- Prosapogenin A2
- Ginsenoside Rh1
- β-D-Glucopyranoside, (3β,6α,12β)-3,12,20-trihydroxydammar-24-en-6-yl
- Dammarane, β-D-glucopyranoside deriv.
