CAS 63224-17-9

N-[2-(dimethylamino)ethyl]-2-methylpropanamide

Description:

N-[2-(dimethylamino)ethyl]-2-methylpropanamide, also known by its CAS number 63224-17-9, is an organic compound characterized by its amide functional group. This substance features a branched alkyl chain, specifically a 2-methylpropanamide structure, which contributes to its hydrophobic properties. The presence of a dimethylamino group enhances its basicity and potential for forming hydrogen bonds, making it soluble in polar solvents. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. This compound is often utilized in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in medicinal chemistry, particularly in drug design, due to the presence of the dimethylamino group, which can influence biological activity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₈N₂O

InChI: InChI=1/C8H18N2O/c1-7(2)8(11)9-5-6-10(3)4/h7H,5-6H2,1-4H3,(H,9,11)

SMILES: CC(C)C(=NCCN(C)C)O

N-[2-(Dimethylamino)ethyl]-2-methylpropanamide

CAS: 63224-17-9

Versatile small molecule scaffold

Formula: C₈H₁₈N₂O

Purity: Min. 95%

Molecular weight: 158.24 g/mol

Ref: 3D-NCA22417