CymitQuimica logo

CAS 63224-42-0

:

4,7-dibromo-2,1,3-benzoselenadiazole

Description:
4,7-Dibromo-2,1,3-benzoselenadiazole is an organic compound characterized by its unique structure, which includes a selenadiazole ring fused to a benzene moiety. This compound features two bromine substituents at the 4 and 7 positions of the selenadiazole ring, which significantly influence its chemical reactivity and physical properties. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. The presence of bromine atoms enhances its electron-withdrawing characteristics, making it useful in various applications, including organic electronics and as a potential building block in the synthesis of more complex molecules. Additionally, the selenadiazole moiety can impart interesting photophysical properties, making it a candidate for studies in materials science and photochemistry. Its solubility is generally limited in non-polar solvents, and it may require specific conditions for effective handling and storage due to its reactivity and potential toxicity. As with many organobromine compounds, safety precautions should be observed during its use.
Formula:C6H2Br2N2Se
InChI:InChI=1/C6H2Br2N2Se/c7-3-1-2-4(8)6-5(3)9-11-10-6/h1-2H
InChI key:MVYRQFKGUCDJAB-UHFFFAOYSA-N
SMILES:c1cc(c2c(c1Br)n[se]n2)Br
Synonyms:
  • 4,7-Dibromo-2,1,3-benzoselenadiazole
Found 5 products.