CymitQuimica logo

CAS 6323-21-3

:

2-(hydroxymethyl)-5-methoxypyridin-4(1H)-one

Description:
2-(Hydroxymethyl)-5-methoxypyridin-4(1H)-one, with the CAS number 6323-21-3, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with a hydroxymethyl group and a methoxy group, contributing to its unique chemical properties. It is typically characterized by its ability to participate in various chemical reactions due to the presence of functional groups, such as the hydroxymethyl and methoxy moieties, which can engage in hydrogen bonding and other interactions. The compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its solubility in polar solvents is likely due to the hydroxymethyl group, while the methoxy group can influence its lipophilicity. Additionally, the compound's stability and reactivity can be affected by the electronic effects of the substituents on the pyridine ring. Overall, 2-(hydroxymethyl)-5-methoxypyridin-4(1H)-one is a versatile compound with potential applications in various fields, including medicinal chemistry and agrochemicals.
Formula:C7H9NO3
InChI:InChI=1/C7H9NO3/c1-11-7-3-8-5(4-9)2-6(7)10/h2-3,9H,4H2,1H3,(H,8,10)
InChI key:LEQMEXDHGCSIGW-UHFFFAOYSA-N
SMILES:COc1c[nH]c(cc1=O)CO
Synonyms:
  • 2-(Hydroxymethyl)-5-methoxypyridin-4-ol
  • 2-Pyridinemethanol, 4-Hydroxy-5-Methoxy-
Found 5 products.