CAS 63233-46-5

N-[3-nitro-4-(pyridin-2-ylmethyl)phenyl]butanamide

Description:

N-[3-nitro-4-(pyridin-2-ylmethyl)phenyl]butanamide, with the CAS number 63233-46-5, is a chemical compound characterized by its complex structure, which includes a butanamide functional group attached to a phenyl ring that is further substituted with a nitro group and a pyridine moiety. This compound typically exhibits properties associated with both amides and aromatic nitro compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitro group. The pyridine ring may contribute to its biological activity, making it of interest in medicinal chemistry. The presence of the butanamide group suggests potential applications in drug development, particularly in the design of compounds with specific pharmacological properties. Additionally, the compound's structure may influence its stability, melting point, and interaction with biological targets. Overall, N-[3-nitro-4-(pyridin-2-ylmethyl)phenyl]butanamide represents a unique chemical entity with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₆H₁₇N₃O₃

InChI: InChI=1/C16H17N3O3/c1-2-5-16(20)18-14-8-7-12(15(11-14)19(21)22)10-13-6-3-4-9-17-13/h3-4,6-9,11H,2,5,10H2,1H3,(H,18,20)

SMILES: CCCC(=Nc1ccc(Cc2ccccn2)c(c1)N(=O)=O)O

Synonyms:

• 2-(4-Butyrylamino-2-Nitrobenzyl)Pyridine

KW-6055

CAS: 63233-46-5

KW-6055 has anti-amnesic activity, is a benzylpyridine derivative.

Formula: C₁₆H₁₇N₃O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 299.32

Ref: TM-T11791