CAS 6324-52-3
:3-Bromo-4-hydroxy-5-methoxybenzoic acid
Description:
3-Bromo-4-hydroxy-5-methoxybenzoic acid, with the CAS number 6324-52-3, is an aromatic compound that features a bromine atom, a hydroxy group, and a methoxy group attached to a benzoic acid framework. This compound is characterized by its molecular structure, which includes a benzene ring substituted with various functional groups that influence its chemical reactivity and properties. The presence of the bromine atom typically enhances the compound's electrophilic character, making it useful in various synthetic applications. The hydroxy group contributes to its acidity and can participate in hydrogen bonding, while the methoxy group can affect the compound's solubility and stability. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and solvents used. Overall, 3-Bromo-4-hydroxy-5-methoxybenzoic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C8H7BrO4
InChI:InChI=1S/C8H7BrO4/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,10H,1H3,(H,11,12)
InChI key:InChIKey=FGOVBTMEPVEFCJ-UHFFFAOYSA-N
SMILES:O(C)C1=CC(C(O)=O)=CC(Br)=C1O
Synonyms:- 3-Bromo-4-Hydroxy-5-Methoxybenzoate
- 3-Bromo-4-hydroxy-5-methoxybenzoic acid
- Ai3-19548
- Benzoic acid, 3-bromo-4-hydroxy-5-methoxy-
- NSC 29084
- Vanillic acid, 5-bromo-
- 5-Bromovanillic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Bromo-4-hydroxy-5-methoxybenzoic acid
CAS:3-Bromo-4-hydroxy-5-methoxybenzoic acid is an organic compound that is a chlorinated derivative of benzoic acid. It can be synthesized by the reaction between benzene and sodium hypochlorite in the presence of a nuclear reactor. The reaction produces 3-bromo-4,5-dihydroxyphenylacetic acid which reacts with chlorine to produce 3,4,5-trichlorobenzoic acid. This compound can then be oxidized to form 3-bromo-4,5-dihydroxybenzoic acid or chlorinated to form 3,4,5,6 -tetrachlorobenzoic acid. The latter compound has been used as a precursor for herbicides such as Benlate and Clorox.Formula:C8H7BrO4Purity:Min. 95%Molecular weight:247.04 g/mol

