CAS 6324-89-6

2,2-dimethyl-1,3-benzodioxol-5-amine

Description:

2,2-Dimethyl-1,3-benzodioxol-5-amine, identified by its CAS number 6324-89-6, is an organic compound characterized by its unique structure, which includes a benzodioxole moiety and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, including potential solubility in organic solvents and moderate reactivity due to the presence of the amine group. The dimethyl substitution on the benzodioxole ring can influence its electronic properties, potentially enhancing its reactivity in various chemical reactions. It may also exhibit biological activity, making it of interest in pharmaceutical and chemical research. The compound's stability, melting point, boiling point, and specific reactivity would depend on the conditions under which it is handled, including temperature and the presence of other reactive species. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance. Overall, 2,2-dimethyl-1,3-benzodioxol-5-amine represents a versatile compound with potential applications in various fields.

Formula: C₉H₁₁NO₂

InChI: InChI=1/C9H11NO2/c1-9(2)11-7-4-3-6(10)5-8(7)12-9/h3-5H,10H2,1-2H3

SMILES: CC1(C)Oc2ccc(cc2O1)N

Synonyms:

• 1,3-Benzodioxol-5-Amine, 2,2-Dimethyl-
• 2,2-Dimethyl-benzo[1,3]dioxol-5-ylamine

2,2-DIMETHYL-BENZO[1,3]DIOXOL-5-YLAMINE

CAS: 6324-89-6

Formula: C₉H₁₁NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 165.1891

Ref: IN-DA00EAW1

2,2-Dimethylbenzo[d][1,3]dioxol-5-amine

CAS: 6324-89-6

2,2-Dimethylbenzo[d][1,3]dioxol-5-amine

Purity: 97%

Molecular weight: 165.19g/mol

Ref: 54-OR92960

2,2-Dimethylbenzo[d][1,3]dioxol-5-amine

CAS: 6324-89-6

Purity: 97%

Molecular weight: 165.1920013

Ref: 10-F689786

2,2-Dimethylbenzo[d][1,3]dioxol-5-amine

CAS: 6324-89-6

Versatile small molecule scaffold

Formula: C₉H₁₁NO₂

Purity: Min. 95%

Molecular weight: 165.19 g/mol

Ref: 3D-GAA32489