CAS 63245-28-3: EHIDA
Description:EHIDA, or Ethylenediamine-N,N'-diacetic acid, is a chelating agent characterized by its ability to form stable complexes with metal ions. It is a white crystalline solid that is soluble in water, making it useful in various applications, including agriculture, pharmaceuticals, and industrial processes. The compound features two amine groups and two carboxylic acid groups, which contribute to its strong chelating properties. EHIDA is often employed to enhance nutrient availability in soil and to prevent metal ion toxicity in biological systems. Additionally, it can be utilized in analytical chemistry for metal ion extraction and separation. Its stability and effectiveness in binding with divalent and trivalent metal ions make it a valuable substance in both research and practical applications. Safety data indicates that while EHIDA is generally considered to have low toxicity, appropriate handling and safety measures should be observed to minimize exposure.
Formula:C16H22N2O5
InChI:InChI=1S/C16H22N2O5/c1-3-11-6-5-7-12(4-2)16(11)17-13(19)8-18(9-14(20)21)10-15(22)23/h5-7H,3-4,8-10H2,1-2H3,(H,17,19)(H,20,21)(H,22,23)
InChI key:InChIKey=WNIDXAKKFOKNEF-UHFFFAOYSA-N
SMILES:O=C(O)CN(CC(=O)O)CC(=O)NC=1C(=CC=CC1CC)CC
- Synonyms:
- 2,2'-((2-((2,6-diethylphenyl)amino)-2-oxoethyl)imino)diacetic Acid
- 2,2'-({2-[(2,6-Diethylphenyl)Amino]-2-Oxoethyl}Ammonio)Diacetate
- 264-041-8
- Diethyl-HIDA
- Ehida
- N-(2,6-Diethylacetanilide)iminodiacetic acid
- N-(Carboxymethyl)-N-(2-((2,6-diethylphenyl)amino)-2-oxoethyl)glycine
- glycine, N-(carboxymethyl)-N-[2-[(2,6-diethylphenyl)amino]-2-oxoethyl]-
- Etifenin
