CAS 6325-43-5

3-[4-(acetylamino)phenyl]propanoic acid

Description:

3-[4-(Acetylamino)phenyl]propanoic acid, with the CAS number 6325-43-5, is an organic compound characterized by its structure, which includes a propanoic acid moiety attached to a phenyl ring that carries an acetylamino substituent. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the carboxylic acid group. The presence of the acetylamino group suggests that it may participate in various chemical reactions, including acylation and amidation. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for interactions with biological targets, which could lead to applications in drug development. Overall, 3-[4-(acetylamino)phenyl]propanoic acid is a versatile compound with potential utility in both synthetic chemistry and medicinal applications.

Formula: C₁₁H₁₃NO₃

InChI: InChI=1/C11H13NO3/c1-8(13)12-10-5-2-9(3-6-10)4-7-11(14)15/h2-3,5-6H,4,7H2,1H3,(H,12,13)(H,14,15)

SMILES: CC(=Nc1ccc(cc1)CCC(=O)O)O

Synonyms:

• 3-(4-Acetamidophenyl)propanoic acid
• Benzenepropanoic Acid, 4-(Acetylamino)-

3-(4-Acetamidophenyl)propanoic acid

CAS: 6325-43-5

Formula: C₁₁H₁₃NO₃

Purity: 97%

Molecular weight: 207.2258

Ref: IN-DA00EJ0B

3-(4-Acetamidophenyl)propanoic acid

CAS: 6325-43-5

Purity: 97%

Molecular weight: 207.2290039

Ref: 10-F684939