CymitQuimica logo

CAS 6325-92-4

:

2-[(Phenylmethyl)thio]benzenamine

Description:
2-[(Phenylmethyl)thio]benzenamine, also known as benzeneethanamine, is an organic compound characterized by the presence of both an amine and a thioether functional group. Its molecular structure features a benzene ring substituted with a phenylmethylthio group and an amino group at the ortho position. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic rings. The presence of the amino group allows for potential hydrogen bonding, which can influence its reactivity and interactions with other molecules. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-donating properties of the amino group. Additionally, the thioether linkage can impart unique properties, such as increased stability against oxidation compared to other sulfur-containing compounds. Overall, 2-[(Phenylmethyl)thio]benzenamine is of interest in synthetic organic chemistry and may have applications in pharmaceuticals and materials science.
Formula:C13H13NS
InChI:InChI=1S/C13H13NS/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-9H,10,14H2
InChI key:InChIKey=YOLYJTSQMGIQOP-UHFFFAOYSA-N
SMILES:S(CC1=CC=CC=C1)C2=C(N)C=CC=C2
Synonyms:
  • Benzenamine, 2-[(phenylmethyl)thio]-
  • 2-Aminophenyl benzyl sulfide
  • 2-Benzylthioaniline
  • Aniline, o-(benzylthio)-
  • 2-[(Phenylmethyl)thio]benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.