CAS 63250-32-8
:(2S)-2-Carboxy-γ-oxo-1-pyrrolidinebutanoic acid
Description:
(2S)-2-Carboxy-γ-oxo-1-pyrrolidinebutanoic acid, also known by its CAS number 63250-32-8, is an amino acid derivative characterized by its pyrrolidine ring structure. This compound features a carboxylic acid functional group and a keto group, contributing to its reactivity and potential biological activity. The presence of the stereocenter at the 2-position indicates that it exists in a specific chiral form, which can influence its interactions in biological systems. This compound is soluble in polar solvents, making it amenable to various chemical reactions and applications in organic synthesis. Its structural features suggest potential roles in biochemical pathways, possibly as an intermediate in the synthesis of more complex molecules or as a building block in peptide synthesis. Additionally, the compound's unique structure may confer specific properties that could be explored in medicinal chemistry or materials science. Overall, (2S)-2-Carboxy-γ-oxo-1-pyrrolidinebutanoic acid represents a versatile compound with implications in both research and application.
Formula:C9H13NO5
InChI:InChI=1S/C9H13NO5/c11-7(3-4-8(12)13)10-5-1-2-6(10)9(14)15/h6H,1-5H2,(H,12,13)(H,14,15)/t6-/m0/s1
InChI key:InChIKey=NEBOPDYAXPDYHQ-LURJTMIESA-N
SMILES:C(CCC(O)=O)(=O)N1[C@H](C(O)=O)CCC1
Synonyms:- (2S)-1-(3-Carboxypropanoyl)pyrrolidine-2-carboxylic acid
- (2S)-2-Carboxy-γ-oxo-1-pyrrolidinebutanoic acid
- 1-(3-carboxypropanoyl)-L-proline
- 1-Pyrrolidinebutanoic acid, 2-carboxy-gamma-oxo-, (S)-
- 1-Pyrrolidinebutanoic acid, 2-carboxy-γ-oxo-, (2S)-
- 1-Pyrrolidinebutanoic acid, 2-carboxy-γ-oxo-, (S)-
- Sq 13745
- Suc-Pro-OH
- Succinyl-L-proline
- Succinylproline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-Succinyl-L-proline
CAS:Controlled ProductFormula:C9H13NO5Color and Shape:NeatMolecular weight:215.203

