CAS 63254-88-6

2-{[(benzyloxy)carbonyl]amino}benzoic acid

Description:

2-{[(Benzyloxy)carbonyl]amino}benzoic acid, also known by its CAS number 63254-88-6, is an organic compound characterized by its structure, which includes a benzoic acid moiety substituted with a benzyloxycarbonyl group. This compound features both an amino group and a carboxylic acid group, making it an amino acid derivative. The presence of the benzyloxy group enhances its lipophilicity, which can influence its solubility and reactivity. It is typically a white to off-white solid and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the benzyloxy group. This compound is often utilized in organic synthesis and pharmaceutical applications, particularly in the development of peptide-based drugs. Its functional groups allow for various chemical reactions, including coupling reactions and modifications that are essential in medicinal chemistry. As with many organic compounds, proper handling and storage are crucial to maintain its stability and efficacy.

Formula: C₁₅H₁₃NO₄

InChI: InChI=1/C15H13NO4/c17-14(18)12-8-4-5-9-13(12)16-15(19)20-10-11-6-2-1-3-7-11/h1-9H,10H2,(H,16,19)(H,17,18)

SMILES: c1ccc(cc1)COC(=Nc1ccccc1C(=O)O)O

2-{[(Benzyloxy)carbonyl]amino}benzoic acid

CAS: 63254-88-6

Versatile small molecule scaffold

Formula: C₁₅H₁₃NO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 271.27 g/mol

Ref: 3D-NCA25488