CAS 63257-29-4
:Demethylblasticidin S
Description:
Demethylblasticidin S is a naturally occurring antibiotic compound that belongs to the class of aminoglycoside antibiotics. It is derived from the fermentation of certain Streptomyces species. This compound is characterized by its ability to inhibit protein synthesis in bacteria, making it effective against a range of Gram-positive and some Gram-negative bacteria. Demethylblasticidin S exhibits a unique structure that includes multiple functional groups, contributing to its biological activity and interaction with ribosomal RNA. The compound is known for its potential applications in research and medicine, particularly in the development of new antimicrobial agents. Its mechanism of action involves binding to the ribosomal subunit, disrupting the translation process, which ultimately leads to bacterial cell death. Additionally, the compound's stability and solubility in various solvents can influence its efficacy and application in laboratory settings. As with many antibiotics, the emergence of resistance is a concern, necessitating ongoing research into its use and the development of derivatives with enhanced activity and reduced resistance potential.
Formula:C16H24N8O5
InChI:InChI=1/C16H24N8O5/c17-8(3-5-21-15(19)20)7-11(25)22-9-1-2-12(29-13(9)14(26)27)24-6-4-10(18)23-16(24)28/h1-2,4,6,8-9,12-13H,3,5,7,17H2,(H,22,25)(H,26,27)(H2,18,23,28)(H4,19,20,21)/t8-,9-,12+,13-/m0/s1
Synonyms:- cas: 63257-29-4
- β-D-erythro-Hex-2-enopyranuronic acid, 4-[[(3S)-3-amino-5-[(aminoiminomethyl)amino]-1-oxopentyl]amino]-1-(4-amino-2-oxo-1(2H)-pyrimidinyl)-1,2,3,4-tetradeoxy- (9CI)
- Demethylblastcidin S
- Demethylblasticidin S
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Demethylblasticidin S
CAS:<p>Demethylblasticidin S is an antifungal antibiotic produced by Streptomyces griseochromogenes.</p>Formula:C16H24N8O5Color and Shape:SolidMolecular weight:408.412
