CAS 63257-31-8
:11-(piperazin-1-ylacetyl)-5,11-dihydro-6H-pyrido[2,3-b][1,4]benzodiazepin-6-one
Description:
11-(Piperazin-1-ylacetyl)-5,11-dihydro-6H-pyrido[2,3-b][1,4]benzodiazepin-6-one, with the CAS number 63257-31-8, is a chemical compound that belongs to the class of benzodiazepines, which are known for their psychoactive properties. This compound features a complex bicyclic structure that includes a pyrido and benzodiazepine moiety, contributing to its potential biological activity. The presence of the piperazine ring suggests possible interactions with neurotransmitter systems, particularly in the central nervous system. Its molecular structure indicates that it may exhibit properties such as anxiolytic, sedative, or anticonvulsant effects, typical of many benzodiazepine derivatives. The compound is likely to be soluble in organic solvents and may have limited solubility in water, which is common for many similar organic compounds. As with any chemical substance, safety and handling precautions are essential, and its pharmacological profile would require thorough investigation through experimental studies to fully understand its therapeutic potential and side effects.
Formula:C18H19N5O2
InChI:InChI=1/C18H19N5O2/c24-16(12-22-10-8-19-9-11-22)23-15-6-2-1-4-13(15)18(25)21-14-5-3-7-20-17(14)23/h1-7,19H,8-12H2,(H,21,25)
SMILES:c1ccc2c(c1)C(=Nc1cccnc1N2C(=O)CN1CCNCC1)O
Synonyms:- 6H-Pyrido(2,3-b)(1,4)benzodiazepin-6-one, 5,11-dihydro-11-(1-piperazinylacetyl)-
- 6H-pyrido[2,3-b][1,4]benzodiazepin-6-one, 5,11-dihydro-11-[2-(1-piperazinyl)acetyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
LS 822
CAS:LS 822 is a metabolite of pirenzepine.Formula:C18H19N5O2Color and Shape:SolidMolecular weight:337.38N-Desmethyl Pirenzepine
CAS:Controlled ProductFormula:C19H20N4O2Color and Shape:NeatMolecular weight:336.39

