CAS 6326-14-3

2,4-Dichlorophenylthiourae

Description:

2,4-Dichlorophenylthiouracil, with the CAS number 6326-14-3, is an organic compound that belongs to the class of thiouracils. It is characterized by the presence of a thiourea functional group and two chlorine atoms substituted on the phenyl ring at the 2 and 4 positions. This compound typically appears as a white to off-white crystalline solid and is known for its role as an antithyroid agent, primarily used in the treatment of hyperthyroidism. Its mechanism of action involves the inhibition of thyroid hormone synthesis by blocking the enzyme thyroid peroxidase, which is crucial for the iodination of tyrosine residues in thyroglobulin. Additionally, 2,4-Dichlorophenylthiouracil exhibits moderate solubility in organic solvents but limited solubility in water. Safety considerations include potential toxicity and side effects, which necessitate careful handling and monitoring during use. Overall, this compound is significant in both pharmaceutical applications and research related to thyroid function and disorders.

Formula: C₇H₆Cl₂N₂S

InChI: InChI=1/C7H6Cl2N2S/c8-4-1-2-6(5(9)3-4)11-7(10)12/h1-3H,(H3,10,11,12)

SMILES: c1cc(c(cc1Cl)Cl)NC(=N)S

1-(2,4-Dichlorophenyl)thiourea

CAS: 6326-14-3

Formula: C₇H₆Cl₂N₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 221.1069

Ref: IN-DA003B4Q

N-(2,4-Dichlorophenyl)thiourea

CAS: 6326-14-3

N-(2,4-Dichlorophenyl)thiourea

Formula: C₇H₆Cl₂N₂S

Purity: 97%

Color and Shape: Powder

Molecular weight: 221.11g/mol

Ref: 54-OR29857

1-(2,4-Dichlorophenyl)-2-thiourea

CAS: 6326-14-3

Formula: C₇H₆Cl₂N₂S

Purity: 98.0%

Color and Shape: Crystalline Powder

Molecular weight: 221.1

Ref: 10-F010664

2,4-Dichlorophenylthiourea

CAS: 6326-14-3

2,4-Dichlorophenylthiourea is a hydrogen-bonding molecule that has dihedral angles of 109.5° and a molecular weight of 202.2 g/mol. 2,4-Dichlorophenylthiourea has been shown to form dimers with benzene and hydrogen bonds with itself and other molecules.

Purity: Min. 95%

Ref: 3D-FD168817