CymitQuimica logo

CAS 6326-42-7

:

methyl 2-iodo-4-nitrobenzoate

Description:
Methyl 2-iodo-4-nitrobenzoate, with the CAS number 6326-42-7, is an organic compound that belongs to the class of benzoates. It features a benzoate structure with a methyl ester group, an iodine atom, and a nitro group positioned on the aromatic ring. The presence of the iodine atom introduces significant reactivity, making it a useful intermediate in various organic synthesis reactions, particularly in nucleophilic substitution reactions. The nitro group, being an electron-withdrawing group, enhances the electrophilicity of the aromatic ring, facilitating further chemical transformations. This compound is typically a solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane. Its applications include serving as a building block in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of iodine and nitro groups, which can be hazardous. Proper storage and disposal methods should be followed to mitigate any environmental impact.
Formula:C8H6INO4
InChI:InChI=1/C8H6INO4/c1-14-8(11)6-3-2-5(10(12)13)4-7(6)9/h2-4H,1H3
InChI key:KRAIRAIRCFXHRZ-UHFFFAOYSA-N
SMILES:COC(=O)c1ccc(cc1I)N(=O)=O
Found 4 products.