CAS 6326-77-8

5-cyclohexyl-5-methylimidazolidine-2,4-dione

Description:

5-Cyclohexyl-5-methylimidazolidine-2,4-dione, with the CAS number 6326-77-8, is an organic compound characterized by its imidazolidine structure, which features a five-membered ring containing two nitrogen atoms. This compound typically exhibits properties associated with cyclic ureas, including potential applications in pharmaceuticals and agrochemicals due to its ability to act as a building block in organic synthesis. The presence of the cyclohexyl and methyl groups contributes to its hydrophobic characteristics, influencing its solubility and reactivity. Additionally, the imidazolidine ring can participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions, making it a versatile intermediate in synthetic chemistry. Its stability and reactivity can be affected by the substituents on the ring, which can modulate its electronic properties. Overall, 5-cyclohexyl-5-methylimidazolidine-2,4-dione is a compound of interest in the field of medicinal chemistry and materials science, warranting further exploration of its properties and potential applications.

Formula: C₁₀H₁₆N₂O₂

InChI: InChI=1/C10H16N2O2/c1-10(7-5-3-2-4-6-7)8(13)11-9(14)12-10/h7H,2-6H2,1H3,(H2,11,12,13,14)

SMILES: CC1(C2CCCCC2)C(=NC(=N1)O)O

Synonyms:

• 2,4-Imidazolidinedione, 5-cyclohexyl-5-methyl-

5-Cyclohexyl-5-methylimidazolidine-2,4-dione

CAS: 6326-77-8

5-Cyclohexyl-5-methylimidazolidine-2,4-dione is a ligand that binds to the receptor and activates it. It is used in research as a tool for studying ion channels, peptides, and protein interactions. 5-Cyclohexyl-5-methylimidazolidine-2,4-dione has been shown to inhibit the binding of an antibody to its antigen.

Formula: C₁₀H₁₆N₂O₂

Purity: Min. 95%

Molecular weight: 196.25 g/mol

Ref: 3D-GAA32677