CAS 63261-45-0

(1S,2S)-trans-1,2-cyclopentanediol

Description:

(1S,2S)-trans-1,2-cyclopentanediol is a bicyclic organic compound characterized by the presence of two hydroxyl (-OH) groups attached to a cyclopentane ring. The specific stereochemistry indicated by the (1S,2S) configuration denotes that both hydroxyl groups are positioned in a cis arrangement relative to each other, which influences the compound's physical and chemical properties. This diol exhibits a relatively high polarity due to the hydroxyl groups, contributing to its solubility in polar solvents like water. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The compound can participate in various chemical reactions, including oxidation and esterification, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and other fine chemicals. Additionally, its stereochemistry may affect its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₅H₁₀O₂

InChI: InChI=1/C5H10O2/c6-4-2-1-3-5(4)7/h4-7H,1-3H2/t4-,5-/m0/s1

SMILES: C1C[C@@H]([C@H](C1)O)O

Synonyms:

• (1S,2S)-cyclopentane-1,2-diol
• (1S)-Trans-1,2-Cyclopentanediol