CAS 6327-93-1

Macrozamin

Description:

Macrozamin, identified by its CAS number 6327-93-1, is a chemical compound that falls under the category of amino acids or their derivatives. While specific details about its physical and chemical properties may vary, compounds in this class typically exhibit characteristics such as being soluble in water and having a defined molecular structure that includes an amino group (-NH2) and a carboxyl group (-COOH). These features contribute to their role in biological systems, often serving as building blocks for proteins or as intermediates in metabolic pathways. Additionally, Macrozamin may possess specific functional groups that influence its reactivity and interactions with other molecules. Its applications could range from pharmaceuticals to biochemistry, depending on its unique properties and biological activity. However, detailed information regarding its specific uses, safety data, and regulatory status would require further investigation into scientific literature and databases.

Formula: C₁₃H₂₄N₂O₁₁

InChI: InChI=1S/C13H24N2O11/c1-15(22)14-4-25-13-11(21)9(19)8(18)6(26-13)3-24-12-10(20)7(17)5(16)2-23-12/h5-13,16-21H,2-4H2,1H3/t5-,6-,7+,8-,9+,10-,11-,12+,13-/m1/s1

InChI key: InChIKey=DQCANINXHQSIAW-OCFMYHKXSA-N

SMILES: C(O[C@H]1[C@H](O)[C@@H](O)[C@H](O)CO1)[C@H]2O[C@@H](OCN=N(C)=O)[C@H](O)[C@@H](O)[C@@H]2O

Synonyms:

• (2-Methyl-2-oxidodiazenyl)methyl 6-O-β-D-xylopyranosyl-β-D-glucopyranoside
• Macrozamin
• β-D-Glucopyranoside, (methyl-ONN-azoxy)methyl 6-O-β-D-xylopyranosyl-
• β-D-Glucopyranoside, (2-methyl-2-oxidodiazenyl)methyl 6-O-β-D-xylopyranosyl-
• NSC 44423

Macrozamin

CAS: 6327-93-1

Formula: C₁₃H₂₄N₂O₁₁

Molecular weight: 384.34

Ref: 7W-GY1343

Macrozamin

CAS: 6327-93-1

Macrozamin

Purity: ≥98%

Molecular weight: 384.34g/mol

Ref: 54-BUP11525

Macrozamin

CAS: 6327-93-1

Formula: C₁₃H₂₄N₂O₁₁

Purity: 95%~99%

Molecular weight: 384.338

Ref: BP-BP4206

Macrozamin

CAS: 6327-93-1

Macrozamin has carcinogenic, mutagenic, teratogenic and neurotoxic properties.Macrozamin is a natural product isolated from Cycads.

Formula: C₁₃H₂₄N₂O₁₁

Purity: 99.77% - 99.95%

Color and Shape: Solid

Molecular weight: 384.34

Ref: TM-T19412

Macrozamin

CAS: 6327-93-1

Natural glycoside

Formula: C₁₃H₂₄N₂O₁₁

Purity: ≥ 90.0 % (HPLC)

Molecular weight: 384.34

Ref: 5G-85756

Macrozamin

CAS: 6327-93-1

Macrozamin is a natural azoxy compound, which is extracted from plants such as cycads. It functions as a potent alkylating agent due to its ability to donate its methyl group to DNA, leading to modifications in the genetic material. This interaction disrupts normal cellular processes, particularly those involved in DNA replication and transcription.

Formula: C₁₃H₂₄N₂O₁₁

Purity: Min. 95%

Molecular weight: 384.34 g/mol

Ref: 3D-GAA32793