CAS 6327-93-1: Macrozamin
Description:Macrozamin, identified by its CAS number 6327-93-1, is a chemical compound that falls under the category of amino acids or their derivatives. While specific details about its physical and chemical properties may vary, compounds in this class typically exhibit characteristics such as being soluble in water and having a defined molecular structure that includes an amino group (-NH2) and a carboxyl group (-COOH). These features contribute to their role in biological systems, often serving as building blocks for proteins or as intermediates in metabolic pathways. Additionally, Macrozamin may possess specific functional groups that influence its reactivity and interactions with other molecules. Its applications could range from pharmaceuticals to biochemistry, depending on its unique properties and biological activity. However, detailed information regarding its specific uses, safety data, and regulatory status would require further investigation into scientific literature and databases.
Formula:C13H24N2O11
InChI:InChI=1S/C13H24N2O11/c1-15(22)14-4-25-13-11(21)9(19)8(18)6(26-13)3-24-12-10(20)7(17)5(16)2-23-12/h5-13,16-21H,2-4H2,1H3/t5-,6-,7+,8-,9+,10-,11-,12+,13-/m1/s1
InChI key:InChIKey=DQCANINXHQSIAW-OCFMYHKXSA-N
SMILES:O=N(=NCOC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O)C
- Synonyms:
- (2-Methyl-2-oxidodiazenyl)methyl 6-O-β-D-xylopyranosyl-β-D-glucopyranoside
- Macrozamin
- β-D-Glucopyranoside, (methyl-ONN-azoxy)methyl 6-O-β-D-xylopyranosyl-
- β-D-Glucopyranoside, (2-methyl-2-oxidodiazenyl)methyl 6-O-β-D-xylopyranosyl-
- NSC 44423
