CAS 6327-97-5
:5-bromo-1-methylpyrimidine-2,4(1H,3H)-dione
Description:
5-Bromo-1-methylpyrimidine-2,4(1H,3H)-dione, with the CAS number 6327-97-5, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains both bromine and methyl substituents. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which contribute to its reactivity and potential applications in organic synthesis. The bromine atom introduces a halogen functionality, enhancing the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The methyl group at the 1-position of the pyrimidine ring can influence the compound's solubility and stability. Typically, compounds of this nature are of interest in medicinal chemistry and agricultural chemistry due to their potential biological activity. Additionally, the presence of the dione structure may allow for tautomeric forms, which can further affect the compound's reactivity and interactions with other molecules. Overall, 5-bromo-1-methylpyrimidine-2,4(1H,3H)-dione is a versatile compound with significant implications in synthetic and applied chemistry.
Formula:C5H5BrN2O2
InChI:InChI=1/C5H5BrN2O2/c1-8-2-3(6)4(9)7-5(8)10/h2H,1H3,(H,7,9,10)
SMILES:Cn1cc(c(nc1=O)O)Br
Synonyms:- 2,4(1H,3H)-pyrimidinedione, 5-bromo-1-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Bromo-1-methylpyrimidine-2,4(1H,3H)-dione
CAS:Formula:C5H5BrN2O2Purity:98%Molecular weight:205.00945-Bromo-1-methylpyrimidine-2,4(1h,3h)-dione
CAS:5-Bromo-1-methylpyrimidine-2,4(1h,3h)-dionePurity:98%Molecular weight:205.01g/mol5-Bromo-1-methylpyrimidine-2,4(1H,3H)-dione
CAS:5-Bromo-1-methylpyrimidine-2,4(1H,3H)-dione is a group p2 enhancement agent that can be used to enhance radiation damage. It has been shown to interact with radiation under 13c-nmr spectroscopy and x-ray diffraction studies. 5-Bromo-1-methylpyrimidine-2,4(1H,3H)-dione can also act as a radical chain or radical in the presence of reactive oxygen species. The ph profile of 5-Bromo-1-methylpyrimidine-2,4(1H,3H)-dione has been studied and it was found that this compound was stable in acidic conditions but unstable in basic conditions. The nmr spectra of 5-Bromo-1-methylpyrimidine 2,4(1H,3H)-dione have been studied and proton signals were observed at 1.Formula:C5H5BrN2O2Purity:Min. 95%Molecular weight:205.01 g/mol



