CAS 63271-86-3

(3-sulfanylphenyl)acetic acid

Description:

(3-Sulfanylphenyl)acetic acid, identified by its CAS number 63271-86-3, is an organic compound characterized by the presence of a phenyl group substituted with a sulfanyl (thiol) group and an acetic acid moiety. This compound features a sulfur atom bonded to a phenyl ring at the meta position, which contributes to its unique chemical properties. The presence of the carboxylic acid functional group (-COOH) makes it acidic, allowing it to participate in various chemical reactions, such as esterification and amidation. The thiol group (-SH) imparts nucleophilic characteristics, enabling it to engage in redox reactions and form disulfide bonds under oxidative conditions. Additionally, (3-sulfanylphenyl)acetic acid may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its solubility in polar solvents and stability under standard conditions are typical for compounds containing both aromatic and functional groups. Overall, this compound's structural features suggest versatility in both synthetic applications and potential biological interactions.

Formula: C₈H₈O₂S

InChI: InChI=1/C8H8O2S/c9-8(10)5-6-2-1-3-7(11)4-6/h1-4,11H,5H2,(H,9,10)

SMILES: c1cc(cc(c1)S)CC(=O)O

Synonyms:

• 2-(3-Mercaptophenyl)acetic acid
• 3-MERCAPTOPHENYLACETIC ACID:90%
• 3-Mercapto-benzeneacetic Acid

2-(3-Mercaptophenyl)acetic acid

CAS: 63271-86-3

Formula: C₈H₈O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 168.2129

Ref: IN-DA00EEFM

2-(3-Mercaptophenyl)acetic acid

CAS: 63271-86-3

2-(3-Mercaptophenyl)acetic acid

Purity: 98%

Molecular weight: 168.22g/mol

Ref: 54-OR1066568

3-Mercaptophenylacetic acid

CAS: 63271-86-3

3-Mercaptophenylacetic acid is an active form of 3-mercaptophenylacetic acid. It is a protein that is used to produce ribonuclease, which is a type of enzyme that breaks down RNA. The hydrolytic reaction of 3-mercaptophenylacetic acid can be facilitated by buffers such as guanidine hydrochloride and thiols such as glutathione. Diazotization with sodium nitrite or diazotization with potassium nitrite followed by treatment with sodium sulfite or potassium bisulfite will convert 3-mercaptophenylacetic acid to 3-mercaptophenol. Denaturant such as urea, guanidine hydrochloride, or triethanolamine can be used to convert the molecule into an aliphatic form. This will expand the molecule and create a more reactive molecule.

Formula: C₈H₈O₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 168.21 g/mol

Ref: 3D-FM25100

2-(3-Mercaptophenyl)acetic acid

CAS: 63271-86-3

Purity: 95%

Molecular weight: 168.2100067

Ref: 10-F775173

3-Mercaptophenylacetic Acid, 90%

Controlled Product

CAS: 63271-86-3

Stability Air Sensitive
Applications A useful synthetic intermediate for the preparation of novel antiinflammatory agents.

Formula: C₈H₈O₂S

Purity: 90%

Color and Shape: Off-White

Molecular weight: 168.2

Ref: TR-M254500