CAS 63271-86-3
:(3-sulfanylphenyl)acetic acid
Description:
(3-Sulfanylphenyl)acetic acid, identified by its CAS number 63271-86-3, is an organic compound characterized by the presence of a phenyl group substituted with a sulfanyl (thiol) group and an acetic acid moiety. This compound features a sulfur atom bonded to a phenyl ring at the meta position, which contributes to its unique chemical properties. The presence of the carboxylic acid functional group (-COOH) makes it acidic, allowing it to participate in various chemical reactions, such as esterification and amidation. The thiol group (-SH) imparts nucleophilic characteristics, enabling it to engage in redox reactions and form disulfide bonds under oxidative conditions. Additionally, (3-sulfanylphenyl)acetic acid may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its solubility in polar solvents and stability under standard conditions are typical for compounds containing both aromatic and functional groups. Overall, this compound's structural features suggest versatility in both synthetic applications and potential biological interactions.
Formula:C8H8O2S
InChI:InChI=1/C8H8O2S/c9-8(10)5-6-2-1-3-7(11)4-6/h1-4,11H,5H2,(H,9,10)
SMILES:c1cc(cc(c1)S)CC(=O)O
Synonyms:- 2-(3-Mercaptophenyl)acetic acid
- 3-MERCAPTOPHENYLACETIC ACID:90%
- 3-Mercapto-benzeneacetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(3-Mercaptophenyl)acetic acid
CAS:Formula:C8H8O2SPurity:95%Color and Shape:SolidMolecular weight:168.21292-(3-Mercaptophenyl)acetic acid
CAS:2-(3-Mercaptophenyl)acetic acidPurity:98%Molecular weight:168.22g/mol3-Mercaptophenylacetic acid
CAS:3-Mercaptophenylacetic acid is an active form of 3-mercaptophenylacetic acid. It is a protein that is used to produce ribonuclease, which is a type of enzyme that breaks down RNA. The hydrolytic reaction of 3-mercaptophenylacetic acid can be facilitated by buffers such as guanidine hydrochloride and thiols such as glutathione. Diazotization with sodium nitrite or diazotization with potassium nitrite followed by treatment with sodium sulfite or potassium bisulfite will convert 3-mercaptophenylacetic acid to 3-mercaptophenol. Denaturant such as urea, guanidine hydrochloride, or triethanolamine can be used to convert the molecule into an aliphatic form. This will expand the molecule and create a more reactive molecule.Formula:C8H8O2SPurity:Min. 95%Color and Shape:PowderMolecular weight:168.21 g/mol3-Mercaptophenylacetic Acid, 90%
CAS:Controlled ProductStability Air Sensitive
Applications A useful synthetic intermediate for the preparation of novel antiinflammatory agents.Formula:C8H8O2SPurity:90%Color and Shape:Off-WhiteMolecular weight:168.2




