CAS 63279-14-1: Rebaudioside E
Description:Rebaudioside E is a natural sweetener derived from the leaves of the Stevia rebaudiana plant, which is known for its high sweetness potency compared to sucrose. It belongs to a class of compounds known as steviol glycosides, which are responsible for the sweet taste of stevia. Rebaudioside E is characterized by its low caloric content, making it a popular choice for sugar substitutes in food and beverage products. It is generally recognized as safe (GRAS) by regulatory agencies when used within established guidelines. The compound is soluble in water and exhibits stability under various pH conditions, which enhances its applicability in different formulations. Additionally, Rebaudioside E has a clean taste profile, lacking the bitter aftertaste associated with some other steviol glycosides, making it an attractive option for consumers seeking healthier alternatives to traditional sweeteners. Its use is expanding in the food industry, particularly in products aimed at reducing sugar intake while maintaining sweetness.
Formula:C44H70O23
InChI:InChI=1S/C44H70O23/c1-17-11-43-9-5-22-41(2,7-4-8-42(22,3)40(59)66-38-34(30(55)26(51)20(14-47)62-38)64-36-32(57)28(53)24(49)18(12-45)60-36)23(43)6-10-44(17,16-43)67-39-35(31(56)27(52)21(15-48)63-39)65-37-33(58)29(54)25(50)19(13-46)61-37/h18-39,45-58H,1,4-16H2,2-3H3/t18-,19-,20-,21-,22+,23+,24-,25-,26-,27-,28+,29+,30+,31+,32-,33-,34-,35-,36+,37+,38+,39+,41-,42-,43-,44+/m1/s1
InChI key:InChIKey=RLLCWNUIHGPAJY-SFUUMPFESA-N
SMILES:O=C(OC1OC(CO)C(O)C(O)C1OC2OC(CO)C(O)C(O)C2O)C3(C)CCCC4(C)C3CCC56CC(=C)C(OC7OC(CO)C(O)C(O)C7OC8OC(CO)C(O)C(O)C8O)(CCC54)C6
- Synonyms:
- Rebaudioside E
- Kaur-16-en-18-oic acid, 13-[(2-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-, 2-O-β-D-glucopyranosyl-β-D-glucopyranosyl ester, (4α)-
![(4R)-13-[[2-O-(β-D-Glucopyranosyl)-β-D-glucopyranosyl]oxy]kaur-16-en-18-oic acid 2-O-(β-D-glucopyr…](https://static.cymitquimica.com/products/IN/thumb/DA00F5US.jpg)
