CAS 6328-74-1

4-Phenoxyphenylacetic acid

Description:

4-Phenoxyphenylacetic acid, with the CAS number 6328-74-1, is an organic compound characterized by its phenylacetic acid structure substituted with a phenoxy group at the para position. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents, while being less soluble in water. It exhibits properties that make it useful in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of both the phenyl and phenoxy groups contributes to its potential biological activity, which has been explored in various studies. Additionally, 4-Phenoxyphenylacetic acid may exhibit certain functional properties such as acidity, which can influence its reactivity and interactions in chemical reactions. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₄H₁₂O₃

InChI: InChI=1/C14H12O3/c15-14(16)10-11-6-8-13(9-7-11)17-12-4-2-1-3-5-12/h1-9H,10H2,(H,15,16)

SMILES: c1ccc(cc1)Oc1ccc(cc1)CC(=O)O

Synonyms:

• (4-Phenoxyphenyl)acetic acid
• Benzeneacetic Acid, 4-Phenoxy-

2-(4-Phenoxyphenyl)acetic acid

CAS: 6328-74-1

Formula: C₁₄H₁₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 228.2433

Ref: IN-DA003LYW

4-Phenoxyphenylacetic acid

CAS: 6328-74-1

4-Phenoxyphenylacetic acid

Purity: 98%

Molecular weight: 228.24g/mol

Ref: 54-OR12795

4-Phenoxyphenylacetic acid

CAS: 6328-74-1

Formula: C₁₄H₁₂O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 228.247

Ref: 10-F164804

4-Phenoxyphenylacetic acid

CAS: 6328-74-1

4-Phenoxyphenylacetic acid is a ligand that is used as a catalyst. It has been shown to catalyze the hydrochlorination of 4-ethoxybenzene to 4-chlorobenzene. 4-Phenoxyphenylacetic acid binds to metals and forms complexes with them, which increases its catalytic activity. The stability of the complex is also increased by the presence of heteroatoms such as chlorine or bromine on the ring system. Ligands that interact with metals are more electronegative than those that do not, and this can affect their stability in the complex.

Formula: C₁₄H₁₂O₃

Purity: Min. 95%

Molecular weight: 228.24 g/mol

Ref: 3D-FP53821