CAS 63283-42-1

(1R)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolinium

Description:

(1R)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolinium is a chemical compound characterized by its tetrahydroisoquinoline structure, which is a bicyclic compound featuring a nitrogen atom within a saturated ring system. The presence of two methoxy groups at the 6 and 7 positions contributes to its unique reactivity and solubility properties, while the methyl group at the 1 position influences its stereochemistry and potential biological activity. This compound is typically studied in the context of medicinal chemistry due to its structural similarity to various bioactive molecules. It may exhibit interesting pharmacological properties, including potential effects on neurotransmitter systems, making it a subject of interest in neuropharmacology. The specific stereochemistry indicated by the (1R) designation suggests a particular spatial arrangement of atoms that can significantly affect the compound's interactions with biological targets. Overall, (1R)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolinium represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₂H₁₈NO₂

InChI: InChI=1/C12H17NO2/c1-8-10-7-12(15-3)11(14-2)6-9(10)4-5-13-8/h6-8,13H,4-5H2,1-3H3/p+1/t8-/m1/s1

Salsolidine (hydrochloride)

CAS: 63283-42-1

Formula: C₁₂H₁₈ClNO₂

Purity: %

Color and Shape: Solid

Molecular weight: 243.7298

Ref: IN-DA003N17

6,7-Dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride

CAS: 63283-42-1

6,7-Dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride

Formula: C₁₂H₁₈NO₂·Cl

Purity: ≥95%

Color and Shape: white solid

Molecular weight: 243.73g/mol

Ref: 54-OR200031

6,7-Dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride

Controlled Product

CAS: 63283-42-1

Applications 6,7-Dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride (cas# 63283-42-1) is a useful research chemical.

Formula: C₁₂H₁₇NO₂·HCl

Color and Shape: Neat

Molecular weight: 243.72

Ref: TR-D496400

6,7-Dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride

CAS: 63283-42-1

Puerarin is a natural compound that is found in the roots of the plant Pueraria lobata. It has been shown to inhibit the binding of dopamine receptor agonists to their receptors, which may be due to its structural similarity to dopamine. Puerarin also inhibits the activity of an enzyme called tyrosine hydroxylase, which converts tyrosine into l-dopa and is a key enzyme in the synthesis of neurotransmitters such as dopamine and norepinephrine. Puerarin has been shown to have anti-inflammatory effects in tissue culture experiments, and it may possess potential for treating autoimmune diseases due to its ability to inhibit inflammatory responses.

Formula: C₁₂H₁₇NO₂·HCl

Purity: Min. 95%

Molecular weight: 243.73 g/mol

Ref: 3D-NCA28342