CAS 6329-73-3

1-(1,3-benzodioxol-5-yl)ethanol

Description:

1-(1,3-benzodioxol-5-yl)ethanol, also known as a derivative of benzodioxole, is an organic compound characterized by its aromatic structure and the presence of a hydroxyl (-OH) group attached to an ethyl chain. This compound features a benzodioxole moiety, which consists of a fused dioxole ring system, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydroxyl group makes it a potential candidate for hydrogen bonding, influencing its solubility in polar solvents like water and alcohols. Additionally, this compound may exhibit biological activity, making it of interest in pharmacological research. Its CAS number, 6329-73-3, allows for easy identification in chemical databases. Overall, 1-(1,3-benzodioxol-5-yl)ethanol is notable for its structural features and potential applications in various fields, including medicinal chemistry and organic synthesis.

Formula: C₉H₁₀O₃

InChI: InChI=1/C9H10O3/c1-6(10)7-2-3-8-9(4-7)12-5-11-8/h2-4,6,10H,5H2,1H3

SMILES: CC(c1ccc2c(c1)OCO2)O

1-(3,4-METHYLENEDIOXYPHENYL)ETHANOL

CAS: 6329-73-3

Formula: C₉H₁₀O₃

Purity: 98%

Color and Shape: Liquid

Molecular weight: 166.1739

Ref: IN-DA00F3L6

1-(Benzo[d][1,3]dioxol-5-yl)ethan-1-ol

CAS: 6329-73-3

1-(Benzo[d][1,3]dioxol-5-yl)ethan-1-ol

Purity: 98%

Ref: 54-OR1040186

1-[3,4-(Methylenedioxy)phenyl]ethanol

CAS: 6329-73-3

Formula: C₉H₁₀O₃

Purity: 98%

Molecular weight: 166.176

Ref: 10-F323123

1-(2H-1,3-Benzodioxol-5-yl)ethan-1-ol

Controlled Product

CAS: 6329-73-3

1-(2H-1,3-Benzodioxol-5-yl)ethan-1-ol (BDO) is an esterase inhibitor that is used in the treatment of a number of diseases. It inhibits the activity of lipases and carboxylic esterases, leading to less pain and inflammation. BDO has been shown to be effective against trichosporon, which is a fungus that causes athlete's foot and other skin infections. BDO also has high efficacy against ibuprofen, an anti-inflammatory drug used for treatment of arthritis. BDO is selective for carboxylic acids over primary alcohols. This means it does not inhibit esterases that hydrolyze secondary or tertiary alcohols such as acetate esters or triglycerides.

Formula: C₉H₁₀O₃

Purity: Min. 95%

Molecular weight: 166.17 g/mol

Ref: 3D-GAA32973