CAS 633-12-5

Tribromobenzoicacid; 97%

Description:

Tribromobenzoic acid, with the CAS number 633-12-5, is an aromatic carboxylic acid characterized by the presence of three bromine atoms attached to a benzoic acid structure. This compound typically appears as a white to off-white crystalline solid and is known for its high melting point. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic bromine substituents. The presence of bromine atoms enhances its reactivity, making it useful in various chemical syntheses, particularly in the field of organic chemistry. Tribromobenzoic acid can serve as a reagent in the preparation of other brominated compounds and is often utilized in research settings for its ability to participate in electrophilic substitution reactions. Additionally, it may exhibit biological activity, which can be of interest in pharmaceutical applications. As with many brominated compounds, handling precautions are necessary due to potential toxicity and environmental concerns.

Formula: C₇H₃Br₃O₂

InChI: InChI=1/C7H3Br3O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H,(H,11,12)

SMILES: c1c(cc(c(c1Br)C(=O)O)Br)Br

Synonyms:

• 2,4,6-Tribromobenzoic acid
• Benzoic acid,2,4,6-tribromo-

2,4,6-Tribromobenzoic Acid

CAS: 633-12-5

Formula: C₇H₃Br₃O₂

Purity: >98.0%(GC)(T)

Color and Shape: White to Orange to Green powder to crystal

Molecular weight: 358.81

Ref: 3B-T0619

2,4,6-Tribromobenzoic acid

CAS: 633-12-5

Formula: C₇H₃Br₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 358.8095

Ref: IN-DA003FMK

2,4,6-Tribromobenzoic acid

CAS: 633-12-5

2,4,6-Tribromobenzoic acid

Purity: 98%

Molecular weight: 358.81g/mol

Ref: 54-OR91264

2,4,6-Tribromobenzoic acid

CAS: 633-12-5

Formula: C₇H₃Br₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 358.811

Ref: 10-F046889