CAS 63304-80-3
:(4-methoxy-3-nitrophenyl)acetic acid
Description:
(4-Methoxy-3-nitrophenyl)acetic acid is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3) and a nitro group (-NO2) attached to a phenyl ring. This compound features an acetic acid functional group, contributing to its acidic properties. The presence of the methoxy group typically enhances the compound's solubility in organic solvents and may influence its reactivity and biological activity. The nitro group is known for its electron-withdrawing properties, which can affect the compound's overall electronic characteristics and reactivity in chemical reactions. (4-Methoxy-3-nitrophenyl)acetic acid may be utilized in various applications, including pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. As with many organic compounds, safety precautions should be taken when handling this substance due to potential toxicity and environmental impact.
Formula:C9H9NO5
InChI:InChI=1/C9H9NO5/c1-15-8-3-2-6(5-9(11)12)4-7(8)10(13)14/h2-4H,5H2,1H3,(H,11,12)
SMILES:COc1ccc(cc1N(=O)=O)CC(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(4-methoxy-3-nitrophenyl)acetic acid
CAS:2-(4-Methoxy-3-nitrophenyl)acetic acid is a linker used in peptide synthesis. It reacts with benzylic alcohols to form stable, cleavable linkages. 2-(4-Methoxy-3-nitrophenyl)acetic acid preferentially reacts with phenylacetic acid and deprotects the benzyl group from a peptide. This product is stable at room temperature and can be used in solid phase chemistry, such as peptide synthesis.Formula:C9H9NO5Purity:Min. 95%Molecular weight:211.2 g/mol


