CymitQuimica logo

CAS 6332-00-9

:

N-methyl-N-nitroso-1-(pyridin-2-yl)methanamine

Description:
N-methyl-N-nitroso-1-(pyridin-2-yl)methanamine, with the CAS number 6332-00-9, is a chemical compound characterized by its nitroso and amine functional groups. It features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of the nitroso group indicates that it may have reactive properties, particularly in biological systems, where it can participate in nitrosation reactions. This compound is typically studied in the context of its potential carcinogenic effects, as nitroso compounds are known to be associated with various health risks. Its molecular structure suggests that it may exhibit polar characteristics due to the presence of nitrogen and the electronegative nature of the pyridine ring. Additionally, the compound's solubility and reactivity can be influenced by the methyl group attached to the nitrogen atom. Overall, N-methyl-N-nitroso-1-(pyridin-2-yl)methanamine is of interest in both synthetic chemistry and toxicology, warranting careful handling and study due to its potential biological implications.
Formula:C7H9N3O
InChI:InChI=1/C7H9N3O/c1-10(9-11)6-7-4-2-3-5-8-7/h2-5H,6H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.