CAS 63321-79-9

{2-[(dimethylamino)methyl]phenyl}methanol

Description:

{2-[(Dimethylamino)methyl]phenyl}methanol, with the CAS number 63321-79-9, is an organic compound characterized by its structure, which features a phenolic group substituted with a dimethylamino group. This compound typically exhibits properties associated with both amines and alcohols, including potential solubility in polar solvents due to the hydroxyl (-OH) group. The presence of the dimethylamino group suggests basicity and the potential for hydrogen bonding, which can influence its reactivity and interaction with other molecules. It may also display biological activity, making it of interest in medicinal chemistry. The compound's molecular structure allows for various functional group transformations, which can be exploited in synthetic applications. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, {2-[(dimethylamino)methyl]phenyl}methanol is a versatile compound with potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₀H₁₅NO

InChI: InChI=1/C10H15NO/c1-11(2)7-9-5-3-4-6-10(9)8-12/h3-6,12H,7-8H2,1-2H3

SMILES: CN(C)Cc1ccccc1CO

Synonyms:

• Benzenemethanol, 2-[(Dimethylamino)Methyl]-

{2-[(Dimethylamino)methyl]phenyl}methanol

CAS: 63321-79-9

Versatile small molecule scaffold

Formula: C₁₀H₁₅NO

Purity: Min. 95%

Molecular weight: 165.23 g/mol

Ref: 3D-NCA32179