CAS 6333-49-9

1-amino-1-deoxyhex-2-ulose acetate (1:1)

Description:

1-Amino-1-deoxyhex-2-ulose acetate (1:1), with the CAS number 6333-49-9, is a chemical compound that belongs to the class of amino sugars. It is characterized by the presence of an amino group (-NH2) and a deoxy sugar structure, specifically a hexose derivative. The compound features a ketone functional group due to its ulosonic structure, which is indicative of its reactivity and potential biological activity. The acetate moiety suggests that it is an ester, which can influence its solubility and stability. This compound may exhibit properties typical of amino sugars, such as involvement in glycosylation processes and potential roles in metabolic pathways. Its structural characteristics allow for interactions with various biological macromolecules, making it of interest in biochemical research. Additionally, the presence of the acetate group can enhance its lipophilicity, affecting its transport and bioavailability in biological systems. Overall, 1-amino-1-deoxyhex-2-ulose acetate is a compound of interest in both synthetic and natural product chemistry.

Formula: C₈H₁₇NO₇

InChI: InChI=1/C6H13NO5.C2H4O2/c7-1-3(9)5(11)6(12)4(10)2-8;1-2(3)4/h4-6,8,10-12H,1-2,7H2;1H3,(H,3,4)

SMILES: C(C(=O)C(C(C(CO)O)O)O)N.CC(=O)O

1-Amino-1-deoxy-D-fructose Acetate

CAS: 6333-49-9

Formula: C₈H₁₇NO₇

Ref: TR-TRC-A604320

1-Amino-1-deoxy-D-fructose Acetate

Controlled Product

CAS: 6333-49-9

Applications 1-Amino-1-deoxy-D-fructose Acetate is an intermediate in the synthesis of inhibitors of sphinogosine-1-phosphate (S1P) lyase for treatment of autoimmune disorders.
References Zhang, H.M., et al.: Tetrahedron., 69, 4041 (2013);

Formula: C₈H₁₇NO₇

Color and Shape: Neat

Molecular weight: 239.22

Ref: TR-A604320