CymitQuimica logo

CAS 6333-79-5

:

4-chloro-N-methylbenzenesulfonamide

Description:
4-Chloro-N-methylbenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group, which is a sulfonic acid derivative containing an amine. This compound features a chlorobenzene ring substituted at the para position with a chlorine atom and an N-methyl group attached to the sulfonamide nitrogen. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the sulfonamide group. The presence of the chlorine atom enhances its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The compound may exhibit biological activity, which can be attributed to its structural features, and it is often studied for its potential therapeutic effects. Safety data indicate that, like many sulfonamides, it should be handled with care due to possible irritant properties. Overall, 4-chloro-N-methylbenzenesulfonamide is a significant compound in organic chemistry with diverse applications.
Formula:C7H8ClNO2S
InChI:InChI=1/C7H8ClNO2S/c1-9-12(10,11)7-4-2-6(8)3-5-7/h2-5,9H,1H3
InChI key:PJHYEBDREIJPKX-UHFFFAOYSA-N
SMILES:CNS(=O)(=O)c1ccc(cc1)Cl
Synonyms:
  • benzenesulfonamide, 4-chloro-N-methyl-
  • 4-chloro-N-methylbenzenesulfonamide
  • 4-Chloro-N-methylbenzenesulphonamide
Found 5 products.