CymitQuimica logo

CAS 633327-50-1

:

5-fluoro-2-methyl-4-nitroaniline

Description:
5-Fluoro-2-methyl-4-nitroaniline is an organic compound characterized by its aromatic amine structure, which includes a fluorine atom, a methyl group, and a nitro group attached to a benzene ring. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The nitro group is known for its electron-withdrawing properties, which can affect the compound's acidity and reactivity in various chemical reactions. This compound is often used in the synthesis of pharmaceuticals and agrochemicals due to its potential biological activity. It may exhibit properties such as antimicrobial or anti-inflammatory effects, making it of interest in medicinal chemistry. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions. Safety data should be consulted, as compounds with nitro and amino groups can pose health risks, including toxicity and environmental hazards. Proper handling and disposal procedures are essential when working with such chemicals.
Formula:C7H7FN2O2
InChI:InChI=1/C7H7FN2O2/c1-4-2-7(10(11)12)5(8)3-6(4)9/h2-3H,9H2,1H3
InChI key:RZRYLRYVZYEYNR-UHFFFAOYSA-N
SMILES:Cc1cc(c(cc1N)F)N(=O)=O
Synonyms:
  • Benzenamine, 5-fluoro-2-methyl-4-nitro-
Found 4 products.