CAS 633328-95-7

5-Bromo-2-chloro-4-methylpyrimidine

Description:

5-Bromo-2-chloro-4-methylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with bromine and chlorine atoms, as well as a methyl group. The presence of these halogen substituents contributes to its reactivity and potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. This compound typically exhibits moderate to high polarity due to the electronegative halogen atoms, which can influence its solubility in polar solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may undergo nucleophilic substitution reactions, which are common for halogenated pyrimidines. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 5-Bromo-2-chloro-4-methylpyrimidine is a valuable building block in organic synthesis, particularly in the development of new chemical entities.

Formula: C₅H₄BrClN₂

InChI: InChI=1/C5H4BrClN2/c1-3-4(6)2-8-5(7)9-3/h2H,1H3

SMILES: Cc1c(cnc(Cl)n1)Br

Synonyms:

• Pyrimidine, 5-Bromo-2-Chloro-4-Methyl-

5-Bromo-2-chloro-4-methylpyrimidine

CAS: 633328-95-7

Formula: C₅H₄BrClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 207.4557

Ref: IN-DA00EFVB

5-Bromo-2-chloro-4-methylpyrimidine

CAS: 633328-95-7

5-Bromo-2-chloro-4-methylpyrimidine

Purity: 97%

Molecular weight: 207.46g/mol

Ref: 54-OR80500

5-Bromo-2-chloro-4-methylpyrimidine

CAS: 633328-95-7

Formula: C₅H₄BrClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 207.46

Ref: 10-F077571