CAS 63335-23-9
:Malabaricone A
Description:
Malabaricone A is a natural compound classified as a phenolic compound, primarily derived from the resin of the tree species *Shorea robusta*, commonly found in the Malabar region of India. It exhibits a complex structure characterized by multiple aromatic rings and functional groups, contributing to its diverse biological activities. Malabaricone A is known for its potential antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in both medicinal and cosmetic applications. The compound has been studied for its effects on various biological pathways, including its ability to modulate oxidative stress and inflammation. Additionally, its unique chemical structure allows for interactions with various biological targets, which may lead to therapeutic benefits. Due to its natural origin, Malabaricone A is also considered for use in sustainable and eco-friendly formulations. However, further research is necessary to fully elucidate its mechanisms of action and potential applications in health and industry.
Formula:C21H26O3
InChI:InChI=1S/C21H26O3/c22-18(21-19(23)15-10-16-20(21)24)14-9-4-2-1-3-6-11-17-12-7-5-8-13-17/h5,7-8,10,12-13,15-16,23-24H,1-4,6,9,11,14H2
InChI key:InChIKey=IAXIHKJASWPASP-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC1=CC=CC=C1)(=O)C2=C(O)C=CC=C2O
Synonyms:- 1-(2,6-Dihydroxyphenyl)-9-phenyl-1-nonanone
- 1-Nonanone, 1-(2,6-dihydroxyphenyl)-9-phenyl-
- NSC 287966
- malabaricone A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Malabaricone A
CAS:Malabaricone A is a bioactive chemical.Formula:C21H26O3Purity:98.44% - 99.12%Color and Shape:SolidMolecular weight:326.43Malabaricone A
CAS:<p>Malabaricone A is a naturally occurring compound, which is a diarylnonanoid isolated from the fruits of Myristica malabarica, commonly known as the Malabar nutmeg tree. This compound exhibits diverse biological activities due to its unique chemical structure, primarily contributing to its mode of action as an antioxidant and anti-inflammatory agent. Malabaricone A scavenges free radicals and modulates cellular pathways involved in the inflammatory response, making it a potential therapeutic candidate in the management of oxidative stress-related disorders.</p>Formula:C21H26O3Purity:Min. 98 Area-%Color and Shape:White Off-White PowderMolecular weight:326.43 g/mol



