CAS 63344-94-5

3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propyl carbamimidothioate hydrobromide (1:1)

Description:

3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propyl carbamimidothioate hydrobromide is a chemical compound characterized by its unique structure, which includes an isoindole moiety and a carbamimidothioate functional group. This compound typically appears as a crystalline solid and is soluble in polar solvents, reflecting its ionic nature due to the presence of the hydrobromide salt. The presence of the dioxo and carbamimidothioate groups suggests potential biological activity, possibly as a pharmaceutical agent or a biochemical probe. Its molecular structure may confer specific reactivity patterns, making it of interest in medicinal chemistry and drug design. The compound's stability, reactivity, and potential applications would depend on the specific conditions under which it is handled, including pH and temperature. As with many chemical substances, safety precautions should be observed when working with this compound, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.

Formula: C₁₂H₁₄BrN₃O₂S

InChI: InChI=1/C12H13N3O2S.BrH/c13-12(14)18-7-3-6-15-10(16)8-4-1-2-5-9(8)11(15)17;/h1-2,4-5H,3,6-7H2,(H3,13,14);1H

SMILES: c1ccc2c(c1)C(=O)N(CCCSC(=N)N)C2=O.Br

{[3-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)propyl]sulfanyl}methanimidamide hydrobromide

CAS: 63344-94-5

Formula: C₁₂H₁₄BrN₃O₂S

Purity: 95.0%

Molecular weight: 344.23

Ref: 10-F525835