
CAS 6335-34-8
:(5Z)-5-(2-chlorobenzylidene)-3-[2-(morpholin-4-yl)-2-oxoethyl]-2-thioxo-1,3-thiazolidin-4-one
Description:
The chemical substance known as (5Z)-5-(2-chlorobenzylidene)-3-[2-(morpholin-4-yl)-2-oxoethyl]-2-thioxo-1,3-thiazolidin-4-one, with the CAS number 6335-34-8, is a thiazolidinone derivative characterized by its unique structural features, including a thiazolidine ring and a thioxo group. This compound typically exhibits biological activity, often investigated for its potential pharmacological properties, including antimicrobial and anti-inflammatory effects. The presence of the morpholine moiety suggests possible interactions with biological targets, enhancing its therapeutic potential. The chlorobenzylidene substituent may influence the compound's lipophilicity and ability to penetrate biological membranes. Additionally, the thiazolidinone framework is known for its role in various medicinal chemistry applications, particularly in the development of drugs targeting metabolic disorders. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry due to their diverse biological activities and potential therapeutic applications.
Formula:C16H15ClN2O3S2
InChI:InChI=1/C16H15ClN2O3S2/c17-12-4-2-1-3-11(12)9-13-15(21)19(16(23)24-13)10-14(20)18-5-7-22-8-6-18/h1-4,9H,5-8,10H2/b13-9-
SMILES:c1ccc(c(c1)/C=C\1/C(=O)N(CC(=O)N2CCOCC2)C(=S)S1)Cl
Synonyms:- 4-thiazolidinone, 5-[(2-chlorophenyl)methylene]-3-[2-(4-morpholinyl)-2-oxoethyl]-2-thioxo-, (5Z)-
- (5Z)-5-(2-Chlorobenzylidene)-3-[2-(morpholin-4-yl)-2-oxoethyl]-2-thioxo-1,3-thiazolidin-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Bromo-N,N-diphenylethanamide
CAS:Flunarizine is a drug that blocks voltage-gated calcium channels. It is used as an anticonvulsant, antiemetic, and to treat migraine headaches. Flunarizine is often called the prototypical l-type calcium channel blocker. It was discovered in 1957 by scientists at the Bristol-Myers Company and has been marketed since 1961 under the trade name of "Akineton". Flunarizine binds to voltage-gated calcium channels in nerve cells and prevents the entry of calcium ions into these cells. This inhibits neurotransmitter release from neurons, which prevents pain signals from being sent to the brain. Flunarizine has been shown to be active against inflammatory pain, but not mechanical pain or neuropathic pain. Flunarizine has also been shown to be an inhibitor of ruthenium complexes with phenyl groups.Purity:Min. 95%



