CAS 6335-97-3
:N-Nitroso-N-octyl-1-octanamine
Description:
N-Nitroso-N-octyl-1-octanamine, with the CAS number 6335-97-3, is a chemical compound that belongs to the class of nitrosamines, which are known for their potential carcinogenic properties. This substance is characterized by the presence of a nitroso group (-N=O) attached to an octyl chain, specifically linked to an octanamine structure. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The compound is soluble in organic solvents but has limited solubility in water. N-Nitroso compounds, including this one, are often formed through the reaction of secondary amines with nitrous acid, and they can be unstable under certain conditions, leading to the release of nitrogen oxides. Due to its potential health risks, particularly in terms of carcinogenicity, handling and usage of N-Nitroso-N-octyl-1-octanamine require strict safety precautions in laboratory and industrial settings. Its applications may be limited due to regulatory concerns surrounding nitrosamines.
Formula:C16H34N2O
InChI:InChI=1S/C16H34N2O/c1-3-5-7-9-11-13-15-18(17-19)16-14-12-10-8-6-4-2/h3-16H2,1-2H3
InChI key:InChIKey=FLYCLWANFMDRKT-UHFFFAOYSA-N
SMILES:N(CCCCCCCC)(CCCCCCCC)N=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Nitrosodioctylamine
CAS:<p>Nitrosodioctylamine is a polycarboxylic acid that is used for the production of chlorinated hydrocarbons. It is also used as an industrial chemical and a polymerization inhibitor. Nitrosodioctylamine can be synthesized from hydrogen chloride and nitric acid, or from sodium nitrate and sulfuric acid. The polymerization inhibition activity of this compound is due to its ability to form cross-links with polyvinyl alcohol. Nitrosodioctylamine has been shown to cause cancer in rats, which may be due to its ability to bind with DNA and inhibit the synthesis of enzyme proteins. Nitrosodioctylamine has also been found to have a sealant effect on metal surfaces that are contaminated by halogen compounds such as chlorine and bromine because it reacts with these compounds to form a layer of insoluble organic material.</p>Formula:C16H34N2OPurity:Min. 95%Molecular weight:270.45 g/mol
