CAS 63357-98-2
:(5S)-Dihydro-5-(2Z)-2-octen-1-yl-2(3H)-furanone
Description:
(5S)-Dihydro-5-(2Z)-2-octen-1-yl-2(3H)-furanone, with the CAS number 63357-98-2, is a chemical compound characterized by its unique structure, which includes a furanone ring and an octenyl side chain. This compound is a chiral molecule, possessing a specific stereochemistry denoted by the (5S) configuration, which can influence its biological activity and interactions. It is typically found in various natural sources and may contribute to the aroma and flavor profiles of certain foods. The presence of the furanone moiety suggests potential reactivity, particularly in forming derivatives through reactions such as nucleophilic addition or condensation. Additionally, its octenyl group may impart hydrophobic characteristics, affecting its solubility and partitioning in different environments. Overall, this compound's structural features suggest it may have applications in flavoring, fragrance, or as a potential bioactive agent in various chemical and biological contexts.
Formula:C12H20O2
InChI:InChI=1S/C12H20O2/c1-2-3-4-5-6-7-8-11-9-10-12(13)14-11/h6-7,11H,2-5,8-10H2,1H3/b7-6-/t11-/m1/s1
InChI key:InChIKey=QFXOXDSHNXAFEY-JMEBYUIHSA-N
SMILES:C(/C=C\CCCCC)[C@H]1OC(=O)CC1
Synonyms:- 2(3H)-Furanone, dihydro-5-(2Z)-2-octenyl-, (5S)-
- 2(3H)-Furanone, dihydro-5-(2Z)-2-octen-1-yl-, (5S)-
- 2(3H)-Furanone, dihydro-5-(2-octenyl)-, [S-(Z)]-
- (S)-(+)-(Z)-4-Hydroxy-6-dodecenoic acid lactone
- (5S)-Dihydro-5-(2Z)-2-octen-1-yl-2(3H)-furanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
