CAS 6336-32-9

5,11-dihydroindolo[3,2-b]carbazole

Description:

5,11-Dihydroindolo[3,2-b]carbazole is a polycyclic aromatic compound characterized by its fused indole and carbazole structures. This compound features a bicyclic framework that contributes to its unique electronic properties, making it of interest in various fields, including organic electronics and materials science. It typically exhibits a planar structure, which enhances its ability to participate in π-π stacking interactions, a key feature for applications in organic semiconductors. The presence of nitrogen atoms in the indole and carbazole moieties can influence its reactivity and solubility, as well as its potential as a ligand in coordination chemistry. Additionally, 5,11-dihydroindolo[3,2-b]carbazole may exhibit photoluminescent properties, making it suitable for use in light-emitting devices. Its stability and reactivity can vary depending on the substituents attached to the core structure, which can be tailored for specific applications. Overall, this compound represents a versatile building block in the development of advanced materials and devices in the field of organic chemistry.

Formula: C₁₈H₁₂N₂

InChI: InChI=1/C18H12N2/c1-3-7-15-11(5-1)13-9-18-14(10-17(13)19-15)12-6-2-4-8-16(12)20-18/h1-10,19-20H

SMILES: c1ccc2c(c1)c1cc3c(cc1[nH]2)c1ccccc1[nH]3

5,11-Dihydroindolo[3,2-b]carbazole

CAS: 6336-32-9

Formula: C₁₈H₁₂N₂

Purity: >98.0%(HPLC)(N)

Color and Shape: White to Yellow to Green powder to crystal

Molecular weight: 256.31

Ref: 3B-D5124

Indolo[3,2-b]carbazole

CAS: 6336-32-9

Formula: C₁₈H₁₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 256.3013

Ref: IN-DA00350Z

5,11-Dihydro-indolo[3,2-b]carbazole

CAS: 6336-32-9

5,11-Dihydro-indolo[3,2-b]carbazole

Purity: 98%

Molecular weight: 256.31g/mol

Ref: 54-OR74993

INDOLO[3,2-B]CARBAZOLE, 5,11-DIHYDRO-

CAS: 6336-32-9

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 256.3080139160156

Ref: 10-F386794