CAS 6337-34-4

2,2-dimethyl-5-phenyl-1,3-dioxolan-4-one

Description:

2,2-Dimethyl-5-phenyl-1,3-dioxolan-4-one, with the CAS number 6337-34-4, is a cyclic organic compound characterized by its dioxolane structure, which features a five-membered ring containing two oxygen atoms. This compound typically exhibits a white to light yellow crystalline appearance and is soluble in organic solvents. The presence of both dimethyl and phenyl groups contributes to its unique chemical properties, including potential reactivity and stability under various conditions. It may participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, due to the electrophilic nature of the carbonyl group in the dioxolanone structure. Additionally, its structural features suggest potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use. Overall, 2,2-dimethyl-5-phenyl-1,3-dioxolan-4-one is a versatile compound with interesting chemical behavior and potential utility in various fields.

Formula: C₁₁H₁₂O₃

InChI: InChI=1/C11H12O3/c1-11(2)13-9(10(12)14-11)8-6-4-3-5-7-8/h3-7,9H,1-2H3

SMILES: CC1(C)OC(c2ccccc2)C(=O)O1

Synonyms:

• 1,3-Dioxolan-4-One, 2,2-Dimethyl-5-Phenyl-

2,2-Dimethyl-5-phenyl-[1,3]dioxolan-4-one

CAS: 6337-34-4

2,2-Dimethyl-5-phenyl-[1,3]dioxolan-4-one

Purity: 95%

Molecular weight: 192.21g/mol

Ref: 54-OR346236