CAS 6337-84-4

4-[(phenylamino)methyl]phenol

Description:

4-[(Phenylamino)methyl]phenol, also known by its CAS number 6337-84-4, is an organic compound characterized by the presence of a phenolic hydroxyl group and an amino group attached to a phenyl ring. This compound typically appears as a solid at room temperature and is soluble in organic solvents, while its solubility in water may vary depending on pH. The structure features a phenol moiety with a phenylamino group, which can influence its reactivity and potential applications in various fields, including pharmaceuticals and dyes. The presence of both the hydroxyl and amino groups allows for hydrogen bonding, which can affect its physical properties such as melting point and boiling point. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and potential toxicity, as with any chemical substance. Overall, 4-[(phenylamino)methyl]phenol is a versatile compound with significant implications in chemical research and application.

Formula: C₁₃H₁₃NO

InChI: InChI=1/C13H13NO/c15-13-8-6-11(7-9-13)10-14-12-4-2-1-3-5-12/h1-9,14-15H,10H2

SMILES: c1ccc(cc1)NCc1ccc(cc1)O

Synonyms:

• Phenol, 4-[(Phenylamino)Methyl]-

4-[(Phenylamino)methyl]phenol hydrochloride

CAS: 6337-84-4

Versatile small molecule scaffold

Formula: C₁₃H₁₄ClNO

Purity: Min. 95%

Molecular weight: 235.71 g/mol

Ref: 3D-GAA33784