CAS 63375-81-5

2-(2-bromo-4,5-dimethoxyphenyl)ethanaminium

Description:

2-(2-bromo-4,5-dimethoxyphenyl)ethanaminium, with the CAS number 63375-81-5, is an organic compound characterized by its quaternary ammonium structure. This substance features a phenyl ring substituted with two methoxy groups and a bromine atom, contributing to its unique chemical properties. The presence of the bromine atom enhances its reactivity, while the methoxy groups can influence its solubility and polarity. As a quaternary ammonium compound, it typically exhibits cationic behavior, which can affect its interactions with biological systems and its potential applications in various fields, including pharmaceuticals and materials science. The compound may also display interesting electrochemical properties due to its ionic nature. Its synthesis and reactivity can be influenced by the substituents on the phenyl ring, making it a subject of interest in organic synthesis and medicinal chemistry. Overall, 2-(2-bromo-4,5-dimethoxyphenyl)ethanaminium is a versatile compound with potential applications in diverse chemical contexts.

Formula: C₁₀H₁₅BrNO₂

InChI: InChI=1/C10H14BrNO2/c1-13-9-5-7(3-4-12)8(11)6-10(9)14-2/h5-6H,3-4,12H2,1-2H3/p+1

SMILES: COc1cc(CCN)c(cc1OC)Br

Synonyms:

• Benzeneethanamine, 2-bromo-4,5-dimethoxy-

2-(2-Bromo-4,5-dimethoxyphenyl)ethan-1-amine

Controlled Product

CAS: 63375-81-5

Versatile small molecule scaffold

Formula: C₁₀H₁₄BrNO₂

Purity: Min. 95%

Molecular weight: 260.13 g/mol

Ref: 3D-NCA37581