CAS 6338-43-8
:2,5-Anhydro-3,4-dideoxyhexaric acid
Description:
2,5-Anhydro-3,4-dideoxyhexaric acid, with the CAS number 6338-43-8, is a chemical compound that belongs to the class of sugar acids. It is characterized by its unique structure, which features an anhydro form of a hexaric acid, indicating the absence of water molecules that would typically be present in its hydrated form. This compound is typically a white to off-white solid and is soluble in water, which is a common trait among many sugar acids. Its molecular structure includes multiple hydroxyl groups, contributing to its reactivity and potential applications in organic synthesis and biochemistry. The presence of dideoxy groups suggests that it may have specific biological activities or roles, particularly in carbohydrate metabolism. Additionally, its anhydro form may influence its stability and reactivity compared to its hydrated counterparts. Overall, 2,5-Anhydro-3,4-dideoxyhexaric acid is of interest in various fields, including medicinal chemistry and carbohydrate chemistry, due to its structural properties and potential applications.
Formula:C6H8O5
InChI:InChI=1/C6H8O5/c7-5(8)3-1-2-4(11-3)6(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)
InChI key:InChIKey=CWZQRDJXBMLSTF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1OC(C(O)=O)CC1
Synonyms:- (2R,5S)-oxolane-2,5-dicarboxylic acid
- 2,5-Furandicarboxylic acid, tetrahydro-
- Hexaric acid, 2,5-anhydro-3,4-dideoxy-
- NSC 40743
- Tetrahydrofuran-2,5-dicarboxylic acid
- cis-Tetrahydro-2,5-furandicarboxylic acid
- 2,5-Anhydro-3,4-dideoxyhexaric acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,5-Furandicarboxylic acid, tetrahydro-
CAS:Formula:C6H8O5Purity:95%Color and Shape:SolidMolecular weight:160.1247Oxolane-2,5-Dicarboxylic Acid
CAS:Oxolane-2,5-Dicarboxylic AcidPurity:95%Molecular weight:160.12g/molTetrahydrofuran-2,5-dicarboxylic Acid (>80%)
CAS:Controlled ProductApplications Tetrahydrofuran-2,5-dicarboxylic acid (CAS# 6338-43-8) is a useful research chemical compound.
Formula:C6H8O5Purity:>80%Color and Shape:NeatMolecular weight:160.12Tetrahydrofuran-2,5-dicarboxylic Acid
CAS:Controlled ProductStability Hygroscopic
Applications Tetrahydrofuran-2,5-dicarboxylic Acid (cas# 2240-81-5) is a compound useful in organic synthesis.Formula:C6H8O5Color and Shape:NeatMolecular weight:160.12Tetrahydrofuran-2,5-dicarboxylic acid
CAS:Tetrahydrofuran-2,5-dicarboxylic acid (THDA) is a polycarboxylic acid that is used in the production of polyurethane foams. THDA can be produced by hydrogenating glycerol with acetic anhydride. This reaction involves protonation of the hydroxyl group followed by ion exchange to create the acidic form of THDA. The kinetic and constant parameters are calculated using a computational method that considers 5-hydroxymethylfurfural as an intermediate.
Formula:C6H8O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:160.12 g/mol




