CAS 6338-47-2

ethyl (4-methyl-1H-imidazol-1-yl)acetate

Description:

Ethyl (4-methyl-1H-imidazol-1-yl)acetate, with the CAS number 6338-47-2, is an organic compound characterized by its imidazole ring structure, which contributes to its unique chemical properties. This substance features an ethyl ester functional group, making it a member of the ester family. It is typically a colorless to pale yellow liquid with a characteristic odor. The presence of the imidazole ring imparts basicity and potential reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Ethyl (4-methyl-1H-imidazol-1-yl)acetate is soluble in organic solvents, which enhances its utility in organic synthesis and as a potential intermediate in the production of pharmaceuticals and agrochemicals. Its stability under standard conditions makes it suitable for various applications, although care should be taken regarding its handling and storage due to potential reactivity. Overall, this compound exemplifies the diverse chemistry associated with imidazole derivatives and esters.

Formula: C₈H₁₂N₂O₂

InChI: InChI=1/C8H12N2O2/c1-3-12-8(11)5-10-4-7(2)9-6-10/h4,6H,3,5H2,1-2H3

SMILES: CCOC(=O)Cn1cc(C)nc1

Ethyl 2-(4-methylimidazol-1-yl)acetate

CAS: 6338-47-2

Ethyl 2-(4-methylimidazol-1-yl)acetate

Purity: 95%

Molecular weight: 168.19g/mol

Ref: 54-OR910439