CymitQuimica logo

CAS 63388-01-2

:

1-(2-hydroxyethyl)-1,3-dihydro-2H-benzimidazol-2-one

Description:
1-(2-Hydroxyethyl)-1,3-dihydro-2H-benzimidazol-2-one, with the CAS number 63388-01-2, is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a hydroxyethyl substituent that enhances its solubility in polar solvents, making it potentially useful in various applications, including pharmaceuticals and biochemistry. The presence of the hydroxyl group contributes to its ability to form hydrogen bonds, which can influence its reactivity and interaction with biological systems. Additionally, the dihydro form indicates that it may exist in a reduced state, affecting its stability and reactivity. This compound may exhibit properties such as antimicrobial or antioxidant activity, typical of many benzimidazole derivatives. Its specific applications and behavior in chemical reactions would depend on further studies, including its interaction with other molecules and its stability under different conditions. Overall, this compound represents a class of substances with diverse potential uses in medicinal chemistry and related fields.
Formula:C9H10N2O2
InChI:InChI=1/C9H10N2O2/c12-6-5-11-8-4-2-1-3-7(8)10-9(11)13/h1-4,12H,5-6H2,(H,10,13)
InChI key:ZONXBNQBUCKCLU-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)nc(n2CCO)O
Synonyms:
  • 2H-Benzimidazol-2-one, 1,3-dihydro-1-(2-hydroxyethyl)-
Found 5 products.